C31H41BrN2O7 — CID 23753065
hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23753065) has the molecular formula C31H41BrN2O7 and a molecular weight of 633.58 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23753065 |
| Molecular Formula | C31H41BrN2O7 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccc(OC)cc2)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C31H41BrN2O7/c1-4-6-7-11-19-40-30(38)24-25-28(36)34(17-9-8-10-18-35)27(31(25)20-23(32)26(24)41-31)29(37)33(16-5-2)21-12-14-22(39-3)15-13-21/h4-5,12-15,23-27,35H,1-2,6-11,16-20H2,3H3/t23?,24-,25+,26-,27?,31?/m1/s1 |
| InChIKey | QDIVNHGGRWPJJU-CLAWUABNSA-N |
| XLogP | 4.02 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|