C30H39BrN2O6 — CID 23924075
but-3-enyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23924075) has the molecular formula C30H39BrN2O6 and a molecular weight of 603.55 g/mol. Its IUPAC name is but-3-enyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23924075 |
| Molecular Formula | C30H39BrN2O6 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | but-3-enyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C30H39BrN2O6/c1-5-7-17-38-29(37)22-23-27(35)33(15-9-8-10-16-34)26(30(23)18-21(31)25(22)39-30)28(36)32(14-6-2)24-19(3)12-11-13-20(24)4/h5-6,11-13,21-23,25-26,34H,1-2,7-10,14-18H2,3-4H3/t21?,22-,23-,25-,26?,30?/m0/s1 |
| InChIKey | WUYCEXPORULRIJ-GHHGOUHNSA-N |
| XLogP | 3.85 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|