C27H35BrN2O6 — CID 23924013
(5R,6R,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23924013) has the molecular formula C27H35BrN2O6 and a molecular weight of 563.49 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5R,6R,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23924013 |
| Molecular Formula | C27H35BrN2O6 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@@H]3OC12CC3Br)c1c(C)cccc1C |
| InChI | InChI=1S/C27H35BrN2O6/c1-4-12-29(21-16(2)10-9-11-17(21)3)25(33)23-27-15-18(28)22(36-27)19(26(34)35)20(27)24(32)30(23)13-7-5-6-8-14-31/h4,9-11,18-20,22-23,31H,1,5-8,12-15H2,2-3H3,(H,34,35)/t18?,19-,20+,22-,23?,27?/m1/s1 |
| InChIKey | LVXBGNMACGDNPM-ZVYYVGQWSA-N |
| XLogP | 3.21 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|