C32H36BrN3O5 — CID 23842152
(5R,6S,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23842152) has the molecular formula C32H36BrN3O5 and a molecular weight of 622.56 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23842152 |
| Molecular Formula | C32H36BrN3O5 |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC(Br)[C@@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C32H36BrN3O5/c1-5-15-34(22-13-8-7-9-14-22)29(38)24-25-30(39)36(17-18-37)28(32(25)19-23(33)27(24)41-32)31(40)35(16-6-2)26-20(3)11-10-12-21(26)4/h5-14,23-25,27-28,37H,1-2,15-19H2,3-4H3/t23?,24-,25-,27-,28?,32?/m0/s1 |
| InChIKey | LHBKYAAPUNPJBC-OVQVJVFSSA-N |
| XLogP | 3.78 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|