C30H31BrClN3O5 — CID 23870088
(5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870088) has the molecular formula C30H31BrClN3O5 and a molecular weight of 628.95 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870088 |
| Molecular Formula | C30H31BrClN3O5 |
| Molecular Weight | 628.95 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccccc2Cl)N(CCO)C(=O)[C@H]13)c1ccccc1 |
| InChI | InChI=1S/C30H31BrClN3O5/c1-3-14-33(19-10-6-5-7-11-19)27(37)23-24-28(38)35(16-17-36)26(30(24)18-20(31)25(23)40-30)29(39)34(15-4-2)22-13-9-8-12-21(22)32/h3-13,20,23-26,36H,1-2,14-18H2/t20?,23-,24+,25-,26?,30?/m1/s1 |
| InChIKey | MZIYCVDXUFBTRJ-AYSMLDIDSA-N |
| XLogP | 3.82 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|