C29H37BrClN3O5 — CID 23981913
(5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981913) has the molecular formula C29H37BrClN3O5 and a molecular weight of 622.99 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981913 |
| Molecular Formula | C29H37BrClN3O5 |
| Molecular Weight | 622.99 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccccc2Cl)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C29H37BrClN3O5/c1-4-13-32(14-5-2)26(36)22-23-27(37)34(16-9-10-17-35)25(29(23)18-19(30)24(22)39-29)28(38)33(15-6-3)21-12-8-7-11-20(21)31/h4,6-8,11-12,19,22-25,35H,1,3,5,9-10,13-18H2,2H3/t19?,22-,23+,24-,25?,29?/m1/s1 |
| InChIKey | WJHIRJDPSHDLLC-JVHOPRNQSA-N |
| XLogP | 3.80 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.99 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|