C35H41BrClN3O5 — CID 23926485
(5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926485) has the molecular formula C35H41BrClN3O5 and a molecular weight of 699.09 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926485 |
| Molecular Formula | C35H41BrClN3O5 |
| Molecular Weight | 699.09 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C35H41BrClN3O5/c1-3-18-38(23-24-14-8-7-9-15-24)32(42)28-29-33(43)40(20-12-5-6-13-21-41)31(35(29)22-25(36)30(28)45-35)34(44)39(19-4-2)27-17-11-10-16-26(27)37/h3-4,7-11,14-17,25,28-31,41H,1-2,5-6,12-13,18-23H2/t25?,28-,29-,30-,31?,35?/m0/s1 |
| InChIKey | VSZWOBBAPGYWHT-KFJSVEOJSA-N |
| XLogP | 5.37 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.09 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|