C37H40BrN3O5 — CID 23813604
(5R,6S,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813604) has the molecular formula C37H40BrN3O5 and a molecular weight of 686.65 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813604 |
| Molecular Formula | C37H40BrN3O5 |
| Molecular Weight | 686.65 g/mol |
| Exact Mass | 685.22 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C37H40BrN3O5/c1-3-18-39(24-25-12-6-5-7-13-25)34(43)30-31-35(44)41(20-10-11-21-42)33(37(31)23-29(38)32(30)46-37)36(45)40(19-4-2)28-17-16-26-14-8-9-15-27(26)22-28/h3-9,12-17,22,29-33,42H,1-2,10-11,18-21,23-24H2/t29?,30-,31-,32-,33?,37?/m0/s1 |
| InChIKey | QXUFJVBWFYKLFI-RDXBXAGKSA-N |
| XLogP | 5.09 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|