C26H31BrN2O7 — CID 23753096
but-3-enyl (5R,6S,7R)-8-bromo-3-(2-hydroxyethyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23753096) has the molecular formula C26H31BrN2O7 and a molecular weight of 563.45 g/mol. Its IUPAC name is but-3-enyl (5R,6S,7R)-8-bromo-3-(2-hydroxyethyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6S,7R)-8-bromo-3-(2-hydroxyethyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23753096 |
| Molecular Formula | C26H31BrN2O7 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | but-3-enyl (5R,6S,7R)-8-bromo-3-(2-hydroxyethyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C26H31BrN2O7/c1-4-6-14-35-25(33)19-20-23(31)29(12-13-30)22(26(20)15-18(27)21(19)36-26)24(32)28(11-5-2)16-7-9-17(34-3)10-8-16/h4-5,7-10,18-22,30H,1-2,6,11-15H2,3H3/t18?,19-,20-,21-,22?,26?/m0/s1 |
| InChIKey | WZKVIKBYDGMVEM-NRNGZIOXSA-N |
| XLogP | 2.07 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|