C32H51BrN2O6 — CID 23753072
hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23753072) has the molecular formula C32H51BrN2O6 and a molecular weight of 639.67 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23753072 |
| Molecular Formula | C32H51BrN2O6 |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | hex-5-enyl (5R,6R,7S)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C32H51BrN2O6/c1-8-10-11-15-19-40-29(39)23-24-27(37)34(17-13-12-14-18-36)26(32(24)20-22(33)25(23)41-32)28(38)35(16-9-2)31(6,7)21-30(3,4)5/h8-9,22-26,36H,1-2,10-21H2,3-7H3/t22?,23-,24+,25-,26?,32?/m1/s1 |
| InChIKey | COJLWHDBNNTOCV-BQBUSGAOSA-N |
| XLogP | 5.03 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|