C29H45BrN2O6 — CID 23782209
prop-2-enyl (5R,6S,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23782209) has the molecular formula C29H45BrN2O6 and a molecular weight of 597.59 g/mol. Its IUPAC name is prop-2-enyl (5R,6S,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5R,6S,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23782209 |
| Molecular Formula | C29H45BrN2O6 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | prop-2-enyl (5R,6S,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C29H45BrN2O6/c1-8-13-32(28(6,7)18-27(3,4)5)25(35)23-29-17-19(30)22(38-29)20(26(36)37-16-9-2)21(29)24(34)31(23)14-11-10-12-15-33/h8-9,19-23,33H,1-2,10-18H2,3-7H3/t19?,20-,21-,22-,23?,29?/m0/s1 |
| InChIKey | AFOYCIDGNZGFQE-IQERYZAKSA-N |
| XLogP | 3.86 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|