C27H42BrN3O5 — CID 23870419
(5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870419) has the molecular formula C27H42BrN3O5 and a molecular weight of 568.55 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870419 |
| Molecular Formula | C27H42BrN3O5 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)C(C)(C)C)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C27H42BrN3O5/c1-7-13-29(6)23(33)19-20-24(34)30(15-11-9-10-12-16-32)22(27(20)17-18(28)21(19)36-27)25(35)31(14-8-2)26(3,4)5/h7-8,18-22,32H,1-2,9-17H2,3-6H3/t18?,19-,20-,21-,22?,27?/m0/s1 |
| InChIKey | ZQFIXQZWJDYJTD-QKHHJSRYSA-N |
| XLogP | 2.74 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|