C23H33BrN2O5S — CID 23810898
but-3-enyl (5S,6S,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23810898) has the molecular formula C23H33BrN2O5S and a molecular weight of 529.50 g/mol. Its IUPAC name is but-3-enyl (5S,6S,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6S,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23810898 |
| Molecular Formula | C23H33BrN2O5S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | but-3-enyl (5S,6S,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)CCCC)N(CCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C23H33BrN2O5S/c1-4-7-10-25(9-6-3)21(29)19-23-14-15(24)18(32-23)16(22(30)31-13-8-5-2)17(23)20(28)26(19)11-12-27/h5-6,15-19,27H,2-4,7-14H2,1H3/t15?,16-,17+,18-,19?,23?/m1/s1 |
| InChIKey | PEKNANDRXAPHPN-JRABERMGSA-N |
| XLogP | 2.38 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|