C32H37BrN2O5S — CID 23951621
but-3-enyl (5S,6S,7S)-8-bromo-3-(5-hydroxypentyl)-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951621) has the molecular formula C32H37BrN2O5S and a molecular weight of 641.63 g/mol. Its IUPAC name is but-3-enyl (5S,6S,7S)-8-bromo-3-(5-hydroxypentyl)-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6S,7S)-8-bromo-3-(5-hydroxypentyl)-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951621 |
| Molecular Formula | C32H37BrN2O5S |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 640.16 |
| IUPAC Name | but-3-enyl (5S,6S,7S)-8-bromo-3-(5-hydroxypentyl)-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)c2ccc4ccccc4c2)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C32H37BrN2O5S/c1-3-5-18-40-31(39)25-26-29(37)35(16-9-6-10-17-36)28(32(26)20-24(33)27(25)41-32)30(38)34(15-4-2)23-14-13-21-11-7-8-12-22(21)19-23/h3-4,7-8,11-14,19,24-28,36H,1-2,5-6,9-10,15-18,20H2/t24?,25-,26+,27-,28?,32?/m1/s1 |
| InChIKey | GNKUUMRMHIBAEX-BCOUIRDNSA-N |
| XLogP | 5.11 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|