C32H43BrN2O5S — CID 23979543
pent-4-enyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23979543) has the molecular formula C32H43BrN2O5S and a molecular weight of 647.68 g/mol. Its IUPAC name is pent-4-enyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23979543 |
| Molecular Formula | C32H43BrN2O5S |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | pent-4-enyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C32H43BrN2O5S/c1-5-7-12-19-40-31(39)24-25-29(37)35(17-10-8-9-11-18-36)28(32(25)20-23(33)27(24)41-32)30(38)34(16-6-2)26-21(3)14-13-15-22(26)4/h5-6,13-15,23-25,27-28,36H,1-2,7-12,16-20H2,3-4H3/t23?,24-,25-,27-,28?,32?/m0/s1 |
| InChIKey | HJHQYWZAWFHQHL-OVQVJVFSSA-N |
| XLogP | 5.35 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|