C28H34BrClN2O5S — CID 23979687
but-3-enyl (5S,6S,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23979687) has the molecular formula C28H34BrClN2O5S and a molecular weight of 626.01 g/mol. Its IUPAC name is but-3-enyl (5S,6S,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6S,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23979687 |
| Molecular Formula | C28H34BrClN2O5S |
| Molecular Weight | 626.01 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | but-3-enyl (5S,6S,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)c2c(C)cccc2Cl)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C28H34BrClN2O5S/c1-4-6-15-37-27(36)20-21-25(34)32(13-7-8-14-33)24(28(21)16-18(29)23(20)38-28)26(35)31(12-5-2)22-17(3)10-9-11-19(22)30/h4-5,9-11,18,20-21,23-24,33H,1-2,6-8,12-16H2,3H3/t18?,20-,21+,23-,24?,28?/m1/s1 |
| InChIKey | IEXXDOQWZTXCKV-TWPOQBFYSA-N |
| XLogP | 4.52 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.01 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|