C28H37BrN2O5S — CID 23978713
ethyl (5S,6S,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23978713) has the molecular formula C28H37BrN2O5S and a molecular weight of 593.58 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23978713 |
| Molecular Formula | C28H37BrN2O5S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@@H]3SC12CC3Br)c1c(C)cccc1C |
| InChI | InChI=1S/C28H37BrN2O5S/c1-5-13-30(22-17(3)11-10-12-18(22)4)26(34)24-28-16-19(29)23(37-28)20(27(35)36-6-2)21(28)25(33)31(24)14-8-7-9-15-32/h5,10-12,19-21,23-24,32H,1,6-9,13-16H2,2-4H3/t19?,20-,21+,23-,24?,28?/m1/s1 |
| InChIKey | PZMFBVHYGFCWCI-OCQGTPIMSA-N |
| XLogP | 4.01 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|