C23H35BrN2O5S — CID 23810110
ethyl (5S,6R,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23810110) has the molecular formula C23H35BrN2O5S and a molecular weight of 531.51 g/mol. Its IUPAC name is ethyl (5S,6R,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23810110 |
| Molecular Formula | C23H35BrN2O5S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | ethyl (5S,6R,7R)-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@H]3SC12CC3Br)C(C)C |
| InChI | InChI=1S/C23H35BrN2O5S/c1-5-10-25(14(3)4)21(29)19-23-13-15(24)18(32-23)16(22(30)31-6-2)17(23)20(28)26(19)11-8-7-9-12-27/h5,14-19,27H,1,6-13H2,2-4H3/t15?,16-,17-,18-,19?,23?/m0/s1 |
| InChIKey | JUYBSPCINJZQOO-KAIDYQAYSA-N |
| XLogP | 2.60 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|