C26H33BrN2O6S — CID 23751909
ethyl (5S,6S,7S)-8-bromo-3-(4-hydroxybutyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751909) has the molecular formula C26H33BrN2O6S and a molecular weight of 581.53 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-3-(4-hydroxybutyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-3-(4-hydroxybutyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751909 |
| Molecular Formula | C26H33BrN2O6S |
| Molecular Weight | 581.53 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-3-(4-hydroxybutyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@@H]3SC12CC3Br)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H33BrN2O6S/c1-4-12-28(16-8-10-17(34-3)11-9-16)24(32)22-26-15-18(27)21(36-26)19(25(33)35-5-2)20(26)23(31)29(22)13-6-7-14-30/h4,8-11,18-22,30H,1,5-7,12-15H2,2-3H3/t18?,19-,20+,21-,22?,26?/m1/s1 |
| InChIKey | DDCALPGWDLNCNM-XRLZSAPBSA-N |
| XLogP | 3.01 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|