C29H38BrN3O5S — CID 23895634
prop-2-enyl (5S,6R,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23895634) has the molecular formula C29H38BrN3O5S and a molecular weight of 620.61 g/mol. Its IUPAC name is prop-2-enyl (5S,6R,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6R,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23895634 |
| Molecular Formula | C29H38BrN3O5S |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | prop-2-enyl (5S,6R,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCO)C(C(=O)N(CC=C)c3ccc(N(CC)CC)cc3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C29H38BrN3O5S/c1-5-14-32(20-12-10-19(11-13-20)31(7-3)8-4)27(36)25-29-18-21(30)24(39-29)22(28(37)38-17-6-2)23(29)26(35)33(25)15-9-16-34/h5-6,10-13,21-25,34H,1-2,7-9,14-18H2,3-4H3/t21?,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | IOZGQIZXWRYHNM-MDLUKOLOSA-N |
| XLogP | 3.63 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|