C26H33BrN2O5S — CID 23979677
(5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23979677) has the molecular formula C26H33BrN2O5S and a molecular weight of 565.53 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23979677 |
| Molecular Formula | C26H33BrN2O5S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@@H]3SC12CC3Br)c1cc(C)ccc1C |
| InChI | InChI=1S/C26H33BrN2O5S/c1-4-10-28(18-13-15(2)8-9-16(18)3)24(32)22-26-14-17(27)21(35-26)19(25(33)34)20(26)23(31)29(22)11-6-5-7-12-30/h4,8-9,13,17,19-22,30H,1,5-7,10-12,14H2,2-3H3,(H,33,34)/t17?,19-,20+,21-,22?,26?/m1/s1 |
| InChIKey | NEPKMNIAOHVLFE-ZYXOHNQQSA-N |
| XLogP | 3.53 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|