C29H40N2O5S — CID 23950530
ethyl (5S,6S,7R)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950530) has the molecular formula C29H40N2O5S and a molecular weight of 528.72 g/mol. Its IUPAC name is ethyl (5S,6S,7R)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7R)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950530 |
| Molecular Formula | C29H40N2O5S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | ethyl (5S,6S,7R)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@H]3CCC12S3)c1cc(C)ccc1C |
| InChI | InChI=1S/C29H40N2O5S/c1-5-15-30(21-18-19(3)11-12-20(21)4)27(34)25-29-14-13-22(37-29)23(28(35)36-6-2)24(29)26(33)31(25)16-9-7-8-10-17-32/h5,11-12,18,22-25,32H,1,6-10,13-17H2,2-4H3/t22-,23+,24+,25?,29?/m1/s1 |
| InChIKey | MNHSLARBRLCYHA-MZQLBTECSA-N |
| XLogP | 4.03 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|