C28H37N5O5S — CID 23978550
ethyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23978550) has the molecular formula C28H37N5O5S and a molecular weight of 555.70 g/mol. Its IUPAC name is ethyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23978550 |
| Molecular Formula | C28H37N5O5S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | ethyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@H]3CCC12S3 |
| InChI | InChI=1S/C28H37N5O5S/c1-3-15-31(18-33-20-12-8-7-11-19(20)29-30-33)26(36)24-28-14-13-21(39-28)22(27(37)38-4-2)23(28)25(35)32(24)16-9-5-6-10-17-34/h3,7-8,11-12,21-24,34H,1,4-6,9-10,13-18H2,2H3/t21-,22+,23+,24?,28?/m1/s1 |
| InChIKey | BYRPTNWWVNWBRO-TVRQESNRSA-N |
| XLogP | 2.61 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|