C31H34N6O4S — CID 23869339
(5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869339) has the molecular formula C31H34N6O4S and a molecular weight of 586.72 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869339 |
| Molecular Formula | C31H34N6O4S |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@H]3CCC12S3 |
| InChI | InChI=1S/C31H34N6O4S/c1-3-16-34(20-37-23-13-9-8-12-22(23)32-33-37)30(41)27-31-15-14-24(42-31)25(26(31)29(40)36(27)18-19-38)28(39)35(17-4-2)21-10-6-5-7-11-21/h3-13,24-27,38H,1-2,14-20H2/t24-,25+,26+,27?,31?/m1/s1 |
| InChIKey | JSXVCAXPFPNIGP-JTDNIMPLSA-N |
| XLogP | 2.71 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|