C31H33BrN6O4S — CID 23754698
(5S,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-8-bromo-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754698) has the molecular formula C31H33BrN6O4S and a molecular weight of 665.61 g/mol. Its IUPAC name is (5S,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-8-bromo-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-8-bromo-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754698 |
| Molecular Formula | C31H33BrN6O4S |
| Molecular Weight | 665.61 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | (5S,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-8-bromo-3-(2-hydroxyethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@@H]3SC12CC3Br |
| InChI | InChI=1S/C31H33BrN6O4S/c1-3-14-35(19-38-23-13-9-8-12-22(23)33-34-38)30(42)27-31-18-21(32)26(43-31)24(25(31)29(41)37(27)16-17-39)28(40)36(15-4-2)20-10-6-5-7-11-20/h3-13,21,24-27,39H,1-2,14-19H2/t21?,24-,25+,26-,27?,31?/m1/s1 |
| InChIKey | YSDGZIXFLZFIEB-MBMPFUGBSA-N |
| XLogP | 3.08 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|