C32H36N6O4S — CID 23925488
(5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925488) has the molecular formula C32H36N6O4S and a molecular weight of 600.75 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925488 |
| Molecular Formula | C32H36N6O4S |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(2-hydroxyethyl)-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@@H]3CC(C)C12S3 |
| InChI | InChI=1S/C32H36N6O4S/c1-4-15-35(20-38-24-14-10-9-13-23(24)33-34-38)31(42)28-32-21(3)19-25(43-32)26(27(32)30(41)37(28)17-18-39)29(40)36(16-5-2)22-11-7-6-8-12-22/h4-14,21,25-28,39H,1-2,15-20H2,3H3/t21?,25-,26+,27-,28?,32?/m0/s1 |
| InChIKey | YCLLEPLNBDTOCO-YGPVABPCSA-N |
| XLogP | 2.95 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|