C34H40N6O5 — CID 23870316
(5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870316) has the molecular formula C34H40N6O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870316 |
| Molecular Formula | C34H40N6O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@@]3(C)OC12CC3C |
| InChI | InChI=1S/C34H40N6O5/c1-5-17-37(22-40-26-16-11-10-15-25(26)35-36-40)32(44)29-34-21-23(3)33(4,45-34)27(28(34)31(43)39(29)19-12-20-41)30(42)38(18-6-2)24-13-8-7-9-14-24/h5-11,13-16,23,27-29,41H,1-2,12,17-22H2,3-4H3/t23?,27-,28+,29?,33+,34?/m1/s1 |
| InChIKey | HGZJVTDZQWVXQP-DUYOIUIDSA-N |
| XLogP | 3.02 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|