C38H57N3O5 — CID 23784368
(5R,6S,7S)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784368) has the molecular formula C38H57N3O5 and a molecular weight of 635.89 g/mol. Its IUPAC name is (5R,6S,7S)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784368 |
| Molecular Formula | C38H57N3O5 |
| Molecular Weight | 635.89 g/mol |
| Exact Mass | 635.43 |
| IUPAC Name | (5R,6S,7S)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)C23CC(C)[C@]1(C)O3)c1ccccc1 |
| InChI | InChI=1S/C38H57N3O5/c1-10-21-39(28-19-15-14-16-20-28)32(43)29-30-33(44)40(23-17-12-13-18-24-42)31(38(30)25-27(3)37(29,9)46-38)34(45)41(22-11-2)36(7,8)26-35(4,5)6/h10-11,14-16,19-20,27,29-31,42H,1-2,12-13,17-18,21-26H2,3-9H3/t27?,29-,30+,31?,37+,38?/m1/s1 |
| InChIKey | VGWWDCGRHLYOMT-QCUOAIRUSA-N |
| XLogP | 6.00 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.89 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|