C40H47N3O5 — CID 23982324
(5R,6R,7R)-3-(6-hydroxyhexyl)-7,8-dimethyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982324) has the molecular formula C40H47N3O5 and a molecular weight of 649.83 g/mol. Its IUPAC name is (5R,6R,7R)-3-(6-hydroxyhexyl)-7,8-dimethyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-3-(6-hydroxyhexyl)-7,8-dimethyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982324 |
| Molecular Formula | C40H47N3O5 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | (5R,6R,7R)-3-(6-hydroxyhexyl)-7,8-dimethyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@]3(C)OC12CC3C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C40H47N3O5/c1-5-22-41(31-18-10-9-11-19-31)36(45)33-34-37(46)43(24-14-7-8-15-25-44)35(40(34)27-28(3)39(33,4)48-40)38(47)42(23-6-2)32-21-20-29-16-12-13-17-30(29)26-32/h5-6,9-13,16-21,26,28,33-35,44H,1-2,7-8,14-15,22-25,27H2,3-4H3/t28?,33-,34-,35?,39+,40?/m0/s1 |
| InChIKey | YAGKXRPQVDBGIC-JPVBTJBXSA-N |
| XLogP | 6.14 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|