C30H36N2O6 — CID 23751829
ethyl (5R,6S,7S)-3-(3-hydroxypropyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751829) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is ethyl (5R,6S,7S)-3-(3-hydroxypropyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7S)-3-(3-hydroxypropyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751829 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | ethyl (5R,6S,7S)-3-(3-hydroxypropyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@@]3(C)OC12CC3C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H36N2O6/c1-5-14-31(22-13-12-20-10-7-8-11-21(20)17-22)27(35)25-30-18-19(3)29(4,38-30)24(28(36)37-6-2)23(30)26(34)32(25)15-9-16-33/h5,7-8,10-13,17,19,23-25,33H,1,6,9,14-16,18H2,2-4H3/t19?,23-,24+,25?,29-,30?/m0/s1 |
| InChIKey | BJMSCHZWDGOQOC-LBZAJBABSA-N |
| XLogP | 3.32 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|