C36H46N2O6 — CID 23951752
hex-5-enyl (5R,6S,7S)-3-(5-hydroxypentyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951752) has the molecular formula C36H46N2O6 and a molecular weight of 602.77 g/mol. Its IUPAC name is hex-5-enyl (5R,6S,7S)-3-(5-hydroxypentyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6S,7S)-3-(5-hydroxypentyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951752 |
| Molecular Formula | C36H46N2O6 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | hex-5-enyl (5R,6S,7S)-3-(5-hydroxypentyl)-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C36H46N2O6/c1-5-7-8-14-22-43-34(42)30-29-32(40)38(20-12-9-13-21-39)31(36(29)24-25(3)35(30,4)44-36)33(41)37(19-6-2)28-18-17-26-15-10-11-16-27(26)23-28/h5-6,10-11,15-18,23,25,29-31,39H,1-2,7-9,12-14,19-22,24H2,3-4H3/t25?,29-,30+,31?,35-,36?/m0/s1 |
| InChIKey | AFANMJOYGOUVLN-AEGCZHKOSA-N |
| XLogP | 5.43 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|