C35H44N2O6 — CID 23782306
hex-5-enyl (5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23782306) has the molecular formula C35H44N2O6 and a molecular weight of 588.75 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23782306 |
| Molecular Formula | C35H44N2O6 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | hex-5-enyl (5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC(C)[C@@]1(C)O3 |
| InChI | InChI=1S/C35H44N2O6/c1-6-9-10-13-19-42-33(41)29-28-31(39)37(26(8-3)22-38)30(35(28)21-23(4)34(29,5)43-35)32(40)36(18-7-2)27-17-16-24-14-11-12-15-25(24)20-27/h6-7,11-12,14-17,20,23,26,28-30,38H,1-2,8-10,13,18-19,21-22H2,3-5H3/t23?,26?,28-,29-,30?,34+,35?/m0/s1 |
| InChIKey | SCLWMPIGFHYLRI-XDUQSJCXSA-N |
| XLogP | 5.04 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|