C27H35ClN2O6 — CID 23950631
ethyl (5R,6S,7S)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950631) has the molecular formula C27H35ClN2O6 and a molecular weight of 519.04 g/mol. Its IUPAC name is ethyl (5R,6S,7S)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7S)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950631 |
| Molecular Formula | C27H35ClN2O6 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | ethyl (5R,6S,7S)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(C(CC)CO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@@]3(C)OC12CC3C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H35ClN2O6/c1-6-13-29(19-11-9-17(28)10-12-19)24(33)22-27-14-16(4)26(5,36-27)21(25(34)35-8-3)20(27)23(32)30(22)18(7-2)15-31/h6,9-12,16,18,20-22,31H,1,7-8,13-15H2,2-5H3/t16?,18?,20-,21+,22?,26-,27?/m0/s1 |
| InChIKey | XCBHPHXIYIYPBG-CMWNPPPNSA-N |
| XLogP | 3.20 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|