C31H42N2O6 — CID 23979851
but-3-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23979851) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is but-3-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23979851 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | but-3-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)N(CC=C)c3cc(C)ccc3C)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C31H42N2O6/c1-8-11-15-38-29(37)25-24-27(35)33(22(10-3)18-34)26(31(24)17-21(6)30(25,7)39-31)28(36)32(14-9-2)23-16-19(4)12-13-20(23)5/h8-9,12-13,16,21-22,24-26,34H,1-2,10-11,14-15,17-18H2,3-7H3/t21?,22?,24-,25+,26?,30-,31?/m0/s1 |
| InChIKey | JKKCFHBUPKXFRR-AIMKXIDJSA-N |
| XLogP | 3.72 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|