C35H41ClN2O6 — CID 23896131
hex-5-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23896131) has the molecular formula C35H41ClN2O6 and a molecular weight of 621.17 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23896131 |
| Molecular Formula | C35H41ClN2O6 |
| Molecular Weight | 621.17 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | hex-5-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)N(CC=C)c3ccc(Cl)cc3)C23CC(C)[C@@]1(C)O3 |
| InChI | InChI=1S/C35H41ClN2O6/c1-5-7-8-12-20-43-33(42)29-28-31(40)38(27(22-39)24-13-10-9-11-14-24)30(35(28)21-23(3)34(29,4)44-35)32(41)37(19-6-2)26-17-15-25(36)16-18-26/h5-6,9-11,13-18,23,27-30,39H,1-2,7-8,12,19-22H2,3-4H3/t23?,27-,28+,29+,30?,34-,35?/m1/s1 |
| InChIKey | SPKUUSCGUQHWAO-QWLDHLDOSA-N |
| XLogP | 5.50 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.17 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|