C33H46N2O6 — CID 23811075
pent-4-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23811075) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is pent-4-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23811075 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | pent-4-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)Cc3ccccc3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C33H46N2O6/c1-5-7-15-21-40-31(39)27-26-29(37)35(19-13-8-9-14-20-36)28(33(26)22-24(3)32(27,4)41-33)30(38)34(18-6-2)23-25-16-11-10-12-17-25/h5-6,10-12,16-17,24,26-28,36H,1-2,7-9,13-15,18-23H2,3-4H3/t24?,26-,27+,28?,32-,33?/m0/s1 |
| InChIKey | HGSAIEBRRKCLKI-FYHRKUAOSA-N |
| XLogP | 4.27 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|