C35H51N3O5 — CID 23784643
(5R,6R,7R)-6-N-benzyl-2-N-butyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784643) has the molecular formula C35H51N3O5 and a molecular weight of 593.81 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-butyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-butyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784643 |
| Molecular Formula | C35H51N3O5 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-butyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCC)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)Cc3ccccc3)[C@]3(C)OC12CC3C |
| InChI | InChI=1S/C35H51N3O5/c1-6-9-21-36(19-7-2)33(42)30-35-24-26(4)34(5,43-35)28(29(35)32(41)38(30)22-15-10-11-16-23-39)31(40)37(20-8-3)25-27-17-13-12-14-18-27/h7-8,12-14,17-18,26,28-30,39H,2-3,6,9-11,15-16,19-25H2,1,4-5H3/t26?,28-,29-,30?,34+,35?/m0/s1 |
| InChIKey | FCKFHGOEGWFAKJ-JHDOXGIESA-N |
| XLogP | 4.58 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|