C37H53N3O5 — CID 23842104
(5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23842104) has the molecular formula C37H53N3O5 and a molecular weight of 619.85 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23842104 |
| Molecular Formula | C37H53N3O5 |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.40 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)C3CCCCC3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C37H53N3O5/c1-5-21-38(26-28-17-11-9-12-18-28)33(42)30-31-34(43)40(23-15-7-8-16-24-41)32(37(31)25-27(3)36(30,4)45-37)35(44)39(22-6-2)29-19-13-10-14-20-29/h5-6,9,11-12,17-18,27,29-32,41H,1-2,7-8,10,13-16,19-26H2,3-4H3/t27?,30-,31+,32?,36+,37?/m1/s1 |
| InChIKey | BTMQVSHZLLCNKE-BUKGJAFUSA-N |
| XLogP | 5.11 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|