C31H42N2O6 — CID 23867141
pent-4-enyl (5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23867141) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is pent-4-enyl (5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23867141 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | pent-4-enyl (5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)Cc3ccccc3)C23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C31H42N2O6/c1-4-6-13-21-38-29(37)25-24-27(35)33(19-11-8-12-20-34)26(31(24)17-16-30(25,3)39-31)28(36)32(18-5-2)22-23-14-9-7-10-15-23/h4-5,7,9-10,14-15,24-26,34H,1-2,6,8,11-13,16-22H2,3H3/t24-,25-,26?,30+,31?/m0/s1 |
| InChIKey | ZTQBCTYHUVUAJQ-QXNGRZIVSA-N |
| XLogP | 3.64 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|