C37H47N3O5 — CID 23980607
(5R,6R,7R)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980607) has the molecular formula C37H47N3O5 and a molecular weight of 613.80 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980607 |
| Molecular Formula | C37H47N3O5 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C37H47N3O5/c1-6-21-38(25-28-17-10-8-11-18-28)33(42)29-30-34(43)40(23-12-9-13-24-41)32(37(30)20-19-36(29,5)45-37)35(44)39(22-7-2)31-26(3)15-14-16-27(31)4/h6-8,10-11,14-18,29-30,32,41H,1-2,9,12-13,19-25H2,3-5H3/t29-,30-,32?,36+,37?/m0/s1 |
| InChIKey | SSXXNCCBDDXAPJ-TTYDYEDWSA-N |
| XLogP | 4.96 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|