C33H38ClN3O5 — CID 23868545
(5R,6S,7S)-2-N-(4-chlorophenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868545) has the molecular formula C33H38ClN3O5 and a molecular weight of 592.14 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868545 |
| Molecular Formula | C33H38ClN3O5 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@]3(C)CCC12O3)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H38ClN3O5/c1-4-19-35(24-11-7-6-8-12-24)29(39)26-27-30(40)37(21-9-10-22-38)28(33(27)18-17-32(26,3)42-33)31(41)36(20-5-2)25-15-13-23(34)14-16-25/h4-8,11-16,26-28,38H,1-2,9-10,17-22H2,3H3/t26-,27+,28?,32+,33?/m1/s1 |
| InChIKey | WCLGMMZFSMYJKY-SUBYTZRVSA-N |
| XLogP | 4.62 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|