C39H45N3O6 — CID 23782610
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782610) has the molecular formula C39H45N3O6 and a molecular weight of 651.80 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782610 |
| Molecular Formula | C39H45N3O6 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccc(OCC)cc3)[C@]3(C)CCC12O3)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C39H45N3O6/c1-5-22-40(29-16-18-31(19-17-29)47-7-3)35(44)32-33-36(45)42(24-10-11-25-43)34(39(33)21-20-38(32,4)48-39)37(46)41(23-6-2)30-15-14-27-12-8-9-13-28(27)26-30/h5-6,8-9,12-19,26,32-34,43H,1-2,7,10-11,20-25H2,3-4H3/t32-,33+,34?,38+,39?/m1/s1 |
| InChIKey | GKCFJNWUMWSYMX-KADSIJIJSA-N |
| XLogP | 5.51 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|