C32H39N3O5 — CID 23839999
(5R,6S,7S)-3-(2-hydroxyethyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23839999) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is (5R,6S,7S)-3-(2-hydroxyethyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-(2-hydroxyethyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23839999 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | (5R,6S,7S)-3-(2-hydroxyethyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC[C@]1(C)O3 |
| InChI | InChI=1S/C32H39N3O5/c1-5-16-33(17-6-2)28(37)25-26-29(38)35(19-20-36)27(32(26)15-14-31(25,4)40-32)30(39)34(18-7-3)24-13-12-22-10-8-9-11-23(22)21-24/h5,7-13,21,25-27,36H,1,3,6,14-20H2,2,4H3/t25-,26+,27?,31+,32?/m1/s1 |
| InChIKey | NJKSNRUMXNCZRT-MJOOVBJDSA-N |
| XLogP | 3.54 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|