C35H45N3O4S — CID 23953213
(5S,6S,7R)-3-(5-hydroxypentyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953213) has the molecular formula C35H45N3O4S and a molecular weight of 603.83 g/mol. Its IUPAC name is (5S,6S,7R)-3-(5-hydroxypentyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-(5-hydroxypentyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953213 |
| Molecular Formula | C35H45N3O4S |
| Molecular Weight | 603.83 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | (5S,6S,7R)-3-(5-hydroxypentyl)-7-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C35H45N3O4S/c1-5-19-36(20-6-2)31(40)28-29-32(41)38(22-11-8-12-23-39)30(35(29)18-17-34(28,4)43-35)33(42)37(21-7-3)27-16-15-25-13-9-10-14-26(25)24-27/h5,7,9-10,13-16,24,28-30,39H,1,3,6,8,11-12,17-23H2,2,4H3/t28-,29-,30?,34+,35?/m0/s1 |
| InChIKey | DNJDNAUDNCEWRM-WRVVCREOSA-N |
| XLogP | 5.43 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|