C28H32N2O5S — CID 23839400
(5S,6S,7R)-3-(4-hydroxybutyl)-7-methyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23839400) has the molecular formula C28H32N2O5S and a molecular weight of 508.64 g/mol. Its IUPAC name is (5S,6S,7R)-3-(4-hydroxybutyl)-7-methyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6S,7R)-3-(4-hydroxybutyl)-7-methyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23839400 |
| Molecular Formula | C28H32N2O5S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (5S,6S,7R)-3-(4-hydroxybutyl)-7-methyl-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@@]3(C)CCC12S3)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H32N2O5S/c1-3-14-29(20-11-10-18-8-4-5-9-19(18)17-20)25(33)23-28-13-12-27(2,36-28)22(26(34)35)21(28)24(32)30(23)15-6-7-16-31/h3-5,8-11,17,21-23,31H,1,6-7,12-16H2,2H3,(H,34,35)/t21-,22-,23?,27+,28?/m0/s1 |
| InChIKey | NPCQIQWSODGDCT-VUEAGESLSA-N |
| XLogP | 3.70 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|