C24H29ClN2O5S — CID 23752516
(5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23752516) has the molecular formula C24H29ClN2O5S and a molecular weight of 493.03 g/mol. Its IUPAC name is (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23752516 |
| Molecular Formula | C24H29ClN2O5S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)O)[C@]3(C)CCC12S3)c1ccccc1Cl |
| InChI | InChI=1S/C24H29ClN2O5S/c1-3-12-26(16-9-5-4-8-15(16)25)21(30)19-24-11-10-23(2,33-24)18(22(31)32)17(24)20(29)27(19)13-6-7-14-28/h3-5,8-9,17-19,28H,1,6-7,10-14H2,2H3,(H,31,32)/t17-,18+,19?,23-,24?/m0/s1 |
| InChIKey | FBYJUOWTGDIZIL-YCDVZCMLSA-N |
| XLogP | 3.20 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|