C32H43ClN2O5S — CID 23781617
hex-5-enyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23781617) has the molecular formula C32H43ClN2O5S and a molecular weight of 603.23 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23781617 |
| Molecular Formula | C32H43ClN2O5S |
| Molecular Weight | 603.23 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | hex-5-enyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C32H43ClN2O5S/c1-4-6-7-14-22-40-30(39)26-25-28(37)35(20-12-8-9-13-21-36)27(32(25)18-17-31(26,3)41-32)29(38)34(19-5-2)24-16-11-10-15-23(24)33/h4-5,10-11,15-16,25-27,36H,1-2,6-9,12-14,17-22H2,3H3/t25-,26+,27?,31-,32?/m0/s1 |
| InChIKey | AEZLJYQXMPEAFY-GTPGOPBBSA-N |
| XLogP | 5.79 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.23 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|