C36H45N3O4S — CID 23980930
(5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980930) has the molecular formula C36H45N3O4S and a molecular weight of 615.84 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980930 |
| Molecular Formula | C36H45N3O4S |
| Molecular Weight | 615.84 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)c3cc(C)ccc3C)C23CC[C@]1(C)S3)c1ccccc1 |
| InChI | InChI=1S/C36H45N3O4S/c1-6-20-37(27-14-10-8-11-15-27)32(41)29-30-33(42)39(22-12-9-13-23-40)31(36(30)19-18-35(29,5)44-36)34(43)38(21-7-2)28-24-25(3)16-17-26(28)4/h6-8,10-11,14-17,24,29-31,40H,1-2,9,12-13,18-23H2,3-5H3/t29-,30+,31?,35+,36?/m1/s1 |
| InChIKey | QQKSIJKFQFKOBF-CUNXNXGYSA-N |
| XLogP | 5.69 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.84 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|