C31H43N3O4S — CID 23869525
(5S,6S,7R)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-N-pentan-2-yl-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869525) has the molecular formula C31H43N3O4S and a molecular weight of 553.77 g/mol. Its IUPAC name is (5S,6S,7R)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-N-pentan-2-yl-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-N-pentan-2-yl-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869525 |
| Molecular Formula | C31H43N3O4S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | (5S,6S,7R)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-N-pentan-2-yl-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@H]2C(=O)N(CCCO)C(C(=O)N(CC=C)C(C)CCC)C23CC[C@@]1(C)S3)c1ccccc1 |
| InChI | InChI=1S/C31H43N3O4S/c1-6-13-22(4)32(18-7-2)29(38)26-31-17-16-30(5,39-31)24(25(31)28(37)34(26)20-12-21-35)27(36)33(19-8-3)23-14-10-9-11-15-23/h7-11,14-15,22,24-26,35H,2-3,6,12-13,16-21H2,1,4-5H3/t22?,24-,25-,26?,30+,31?/m0/s1 |
| InChIKey | GGODCZVJABTIGQ-WBWZQRJWSA-N |
| XLogP | 4.27 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|