C35H42BrN3O4S — CID 23783966
(5S,6S,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783966) has the molecular formula C35H42BrN3O4S and a molecular weight of 680.71 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783966 |
| Molecular Formula | C35H42BrN3O4S |
| Molecular Weight | 680.71 g/mol |
| Exact Mass | 679.21 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)c2cc(C)ccc2C)N(CCCCCO)C(=O)[C@H]13)c1ccccc1 |
| InChI | InChI=1S/C35H42BrN3O4S/c1-5-17-37(25-13-9-7-10-14-25)32(41)28-29-33(42)39(19-11-8-12-20-40)31(35(29)22-26(36)30(28)44-35)34(43)38(18-6-2)27-21-23(3)15-16-24(27)4/h5-7,9-10,13-16,21,26,28-31,40H,1-2,8,11-12,17-20,22H2,3-4H3/t26?,28-,29+,30-,31?,35?/m1/s1 |
| InChIKey | FJUBZDFLBAWREQ-MVMNDOGJSA-N |
| XLogP | 5.67 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|